C21H23F5N6OS — CID 88916726
[(1R,3S)-3-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 88916726) has the molecular formula C21H23F5N6OS and a molecular weight of 502.51 g/mol. Its IUPAC name is [(1R,3S)-3-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 88916726 |
| Molecular Formula | C21H23F5N6OS |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [(1R,3S)-3-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Cc1nc(NCC(F)(F)C(F)(F)F)nc(N[C@H]2CC[C@@H](CO)C2)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C21H23F5N6OS/c1-10-15(18-31-16-11(2)27-6-5-14(16)34-18)17(30-13-4-3-12(7-13)8-33)32-19(29-10)28-9-20(22,23)21(24,25)26/h5-6,12-13,33H,3-4,7-9H2,1-2H3,(H2,28,29,30,32)/t12-,13+/m1/s1 |
| InChIKey | UGZMYMDTFGVFBV-OLZOCXBDSA-N |
| XLogP | 4.95 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|