C22H23F7N6OS — CID 88916728
[(1R,3S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 88916728) has the molecular formula C22H23F7N6OS and a molecular weight of 552.52 g/mol. Its IUPAC name is [(1R,3S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 88916728 |
| Molecular Formula | C22H23F7N6OS |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | [(1R,3S)-3-[[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Cc1nc(NCC(F)(F)C(F)(F)C(F)(F)F)nc(N[C@H]2CC[C@@H](CO)C2)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C22H23F7N6OS/c1-10-15(18-34-16-11(2)30-6-5-14(16)37-18)17(33-13-4-3-12(7-13)8-36)35-19(32-10)31-9-20(23,24)21(25,26)22(27,28)29/h5-6,12-13,36H,3-4,7-9H2,1-2H3,(H2,31,32,33,35)/t12-,13+/m1/s1 |
| InChIKey | DXWPBWRMNNGJQM-OLZOCXBDSA-N |
| XLogP | 5.58 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|