C12H17F6N3O8S3 — CID 88916749
1,1,2,2,3,3-hexafluoro-N-methylsulfonyl-3-[4-(2-oxooxolan-3-yl)piperazin-1-yl]sulfonylpropane-1-sulfonamide (PubChem CID 88916749) has the molecular formula C12H17F6N3O8S3 and a molecular weight of 541.47 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-methylsulfonyl-3-[4-(2-oxooxolan-3-yl)piperazin-1-yl]sulfonylpropane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-methylsulfonyl-3-[4-(2-oxooxolan-3-yl)piperazin-1-yl]sulfonylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 88916749 |
| Molecular Formula | C12H17F6N3O8S3 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-methylsulfonyl-3-[4-(2-oxooxolan-3-yl)piperazin-1-yl]sulfonylpropane-1-sulfonamide |
| SMILES | CS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCN(C2CCOC2=O)CC1 |
| InChI | InChI=1S/C12H17F6N3O8S3/c1-30(23,24)19-31(25,26)11(15,16)10(13,14)12(17,18)32(27,28)21-5-3-20(4-6-21)8-2-7-29-9(8)22/h8,19H,2-7H2,1H3 |
| InChIKey | ZZYRFFUPOWFJKB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|