C11H18ClN3 — CID 88917014
1-[(1E,3E)-1-amino-1-chlorohexa-1,3,5-trien-3-yl]piperidin-4-amine (PubChem CID 88917014) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 1-[(1E,3E)-1-amino-1-chlorohexa-1,3,5-trien-3-yl]piperidin-4-amine.
| Compound Name | 1-[(1E,3E)-1-amino-1-chlorohexa-1,3,5-trien-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 88917014 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-[(1E,3E)-1-amino-1-chlorohexa-1,3,5-trien-3-yl]piperidin-4-amine |
| SMILES | C=C/C=C(\C=C(/N)Cl)N1CCC(N)CC1 |
| InChI | InChI=1S/C11H18ClN3/c1-2-3-10(8-11(12)14)15-6-4-9(13)5-7-15/h2-3,8-9H,1,4-7,13-14H2/b10-3+,11-8- |
| InChIKey | VTJLVBPDKLXSNK-XLVBYJSXSA-N |
| XLogP | 1.52 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|