C28H29F3N8OS — CID 88917101
2-[[4-methyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 88917101) has the molecular formula C28H29F3N8OS and a molecular weight of 582.66 g/mol. Its IUPAC name is 2-[[4-methyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[4-methyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 88917101 |
| Molecular Formula | C28H29F3N8OS |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 2-[[4-methyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cnc(Nc3nc(C)nc(N4CCN(c5cccc(C(F)(F)F)c5)CC4)n3)s2)c(C)c1 |
| InChI | InChI=1S/C28H29F3N8OS/c1-16-12-17(2)23(18(3)13-16)35-24(40)22-15-32-27(41-22)37-25-33-19(4)34-26(36-25)39-10-8-38(9-11-39)21-7-5-6-20(14-21)28(29,30)31/h5-7,12-15H,8-11H2,1-4H3,(H,35,40)(H,32,33,34,36,37) |
| InChIKey | FCJPUMNNZSPSRT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |