C93H58N6 — CID 88917355
2,2'-bis[3-(3,5-diphenylphenyl)phenyl]-5,5'-di(pyrimidin-2-yl)-7,7'-spirobi[indeno[2,1-b]carbazole] (PubChem CID 88917355) has the molecular formula C93H58N6 and a molecular weight of 1259.53 g/mol. Its IUPAC name is 2,2'-bis[3-(3,5-diphenylphenyl)phenyl]-5,5'-di(pyrimidin-2-yl)-7,7'-spirobi[indeno[2,1-b]carbazole].
| Compound Name | 2,2'-bis[3-(3,5-diphenylphenyl)phenyl]-5,5'-di(pyrimidin-2-yl)-7,7'-spirobi[indeno[2,1-b]carbazole] |
|---|---|
| PubChem CID | 88917355 |
| Molecular Formula | C93H58N6 |
| Molecular Weight | 1259.53 g/mol |
| Exact Mass | 1258.47 |
| IUPAC Name | 2,2'-bis[3-(3,5-diphenylphenyl)phenyl]-5,5'-di(pyrimidin-2-yl)-7,7'-spirobi[indeno[2,1-b]carbazole] |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4ccc5c(c4)c4cc6c(cc4n5-c4ncccn4)C4(c5ccccc5-6)c5ccccc5-c5cc6c7cc(-c8cccc(-c9cc(-c%10ccccc%10)cc(-c%10ccccc%10)c9)c8)ccc7n(-c7ncccn7)c6cc54)c3)c2)cc1 |
| InChI | InChI=1S/C93H58N6/c1-5-21-59(22-6-1)69-47-70(60-23-7-2-8-24-60)50-73(49-69)65-31-17-29-63(45-65)67-37-39-87-79(53-67)81-55-77-75-33-13-15-35-83(75)93(85(77)57-89(81)98(87)91-94-41-19-42-95-91)84-36-16-14-34-76(84)78-56-82-80-54-68(38-40-88(80)99(90(82)58-86(78)93)92-96-43-20-44-97-92)64-30-18-32-66(46-64)74-51-71(61-25-9-3-10-26-61)48-72(52-74)62-27-11-4-12-28-62/h1-58H |
| InChIKey | JBMYMAXFERJOKT-UHFFFAOYSA-N |
| XLogP | 23.14 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.53 |
| LogP ≤ 5 | 23.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |