C10H13N3OS — CID 88917393
(2S,6R)-4-(4-isocyano-1,3-thiazol-2-yl)-2,6-dimethylmorpholine (PubChem CID 88917393) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is (2S,6R)-4-(4-isocyano-1,3-thiazol-2-yl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(4-isocyano-1,3-thiazol-2-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 88917393 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2S,6R)-4-(4-isocyano-1,3-thiazol-2-yl)-2,6-dimethylmorpholine |
| SMILES | [C-]#[N+]c1csc(N2C[C@@H](C)O[C@@H](C)C2)n1 |
| InChI | InChI=1S/C10H13N3OS/c1-7-4-13(5-8(2)14-7)10-12-9(11-3)6-15-10/h6-8H,4-5H2,1-2H3/t7-,8+ |
| InChIKey | VOXCNMPXEFGSFT-OCAPTIKFSA-N |
| XLogP | 2.31 |
| TPSA | 29.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|