C11H19N3 — CID 88917398
(1E,3Z)-5-methyl-2-piperazin-1-ylhexa-1,3,5-trien-1-amine (PubChem CID 88917398) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1E,3Z)-5-methyl-2-piperazin-1-ylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-methyl-2-piperazin-1-ylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88917398 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1E,3Z)-5-methyl-2-piperazin-1-ylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(C)/C=C\C(=C/N)N1CCNCC1 |
| InChI | InChI=1S/C11H19N3/c1-10(2)3-4-11(9-12)14-7-5-13-6-8-14/h3-4,9,13H,1,5-8,12H2,2H3/b4-3-,11-9+ |
| InChIKey | YUWQNSMSLGDMLD-XOXVZCPUSA-N |
| XLogP | 0.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|