C23H22ClN5O3 — CID 88917690
[4-(5-amino-4-chloro-2-isocyanophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 88917690) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is [4-(5-amino-4-chloro-2-isocyanophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | [4-(5-amino-4-chloro-2-isocyanophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 88917690 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [4-(5-amino-4-chloro-2-isocyanophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | [C-]#[N+]c1cc(Cl)c(N)cc1N1CCN(C(=O)c2c(-c3ccccc3OC)noc2C)CC1 |
| InChI | InChI=1S/C23H22ClN5O3/c1-14-21(22(27-32-14)15-6-4-5-7-20(15)31-3)23(30)29-10-8-28(9-11-29)19-13-17(25)16(24)12-18(19)26-2/h4-7,12-13H,8-11,25H2,1,3H3 |
| InChIKey | PFOXGGRZDNRINR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|