C19H10F6N4OS — CID 88917701
5-[8-oxo-6-sulfanylidene-5-(2,3,6-trifluorophenyl)-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 88917701) has the molecular formula C19H10F6N4OS and a molecular weight of 456.37 g/mol. Its IUPAC name is 5-[8-oxo-6-sulfanylidene-5-(2,3,6-trifluorophenyl)-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[8-oxo-6-sulfanylidene-5-(2,3,6-trifluorophenyl)-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 88917701 |
| Molecular Formula | C19H10F6N4OS |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-[8-oxo-6-sulfanylidene-5-(2,3,6-trifluorophenyl)-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(N2C(=O)C3(CCC3)N(c3c(F)ccc(F)c3F)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C19H10F6N4OS/c20-11-2-3-12(21)15(14(11)22)29-17(31)28(16(30)18(29)4-1-5-18)9-6-10(19(23,24)25)13(7-26)27-8-9/h2-3,6,8H,1,4-5H2 |
| InChIKey | VCDJMUDECDIQCV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|