About 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol
1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol (PubChem CID 88917738) has the molecular formula C19H14Cl2F2N2O
and a molecular weight of 395.24 g/mol. Its IUPAC name is 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol |
| PubChem CID | 88917738 |
| Molecular Formula | C19H14Cl2F2N2O |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol |
| SMILES | Cc1nnc(Cl)c(-c2c(F)cc(C(C)O)cc2F)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2F2N2O/c1-9-16(11-3-5-13(20)6-4-11)18(19(21)25-24-9)17-14(22)7-12(10(2)26)8-15(17)23/h3-8,10,26H,1-2H3 |
| InChIKey | VNIWVWABFSYHMM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol?
The IUPAC name of 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol (CID 88917738) is 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol.
What is the SMILES notation for 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol?
The canonical SMILES for 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol is Cc1nnc(Cl)c(-c2c(F)cc(C(C)O)cc2F)c1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol?
The InChIKey is VNIWVWABFSYHMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2F2N2O/c1-9-16(11-3-5-13(20)6-4-11)18(19(21)25-24-9)17-14(22)7-12(10(2)26)8-15(17)23/h3-8,10,26H,1-2H3.
What are the key properties of 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol?
1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol has a molecular weight of 395.24 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3-chloro-5-(4-chlorophenyl)-6-methylpyridazin-4-yl]-3,5-difluorophenyl]ethanol is sourced from PubChem (CID 88917738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).