C10H15NO2 — CID 88917966
(3S,4S,5R)-3,4,5-trimethyl-N-oxocyclohexene-1-carboxamide (PubChem CID 88917966) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3S,4S,5R)-3,4,5-trimethyl-N-oxocyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3,4,5-trimethyl-N-oxocyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 88917966 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3S,4S,5R)-3,4,5-trimethyl-N-oxocyclohexene-1-carboxamide |
| SMILES | C[C@@H]1[C@H](C)C=C(C(=O)N=O)C[C@H]1C |
| InChI | InChI=1S/C10H15NO2/c1-6-4-9(10(12)11-13)5-7(2)8(6)3/h4,6-8H,5H2,1-3H3/t6-,7-,8-/m1/s1 |
| InChIKey | WWTATKMPPQYNRJ-BWZBUEFSSA-N |
| XLogP | 2.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |