C12H18BNO4 — CID 88917974
2-[(1Z,3Z)-hepta-1,3-dienyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 88917974) has the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 2-[(1Z,3Z)-hepta-1,3-dienyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[(1Z,3Z)-hepta-1,3-dienyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 88917974 |
| Molecular Formula | C12H18BNO4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(1Z,3Z)-hepta-1,3-dienyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CCC/C=C\C=C/B1OC(=O)CN(C)CC(=O)O1 |
| InChI | InChI=1S/C12H18BNO4/c1-3-4-5-6-7-8-13-17-11(15)9-14(2)10-12(16)18-13/h5-8H,3-4,9-10H2,1-2H3/b6-5-,8-7- |
| InChIKey | WETLERWIDYTGSE-ISTTXYCBSA-N |
| XLogP | 0.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|