C34H38F5NO5 — CID 88918043
methyl 1-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperidine-4-carboxylate (PubChem CID 88918043) has the molecular formula C34H38F5NO5 and a molecular weight of 635.67 g/mol. Its IUPAC name is methyl 1-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 88918043 |
| Molecular Formula | C34H38F5NO5 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | methyl 1-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccc([C@H]3CC4(C)[C@@H](CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C34H38F5NO5/c1-31-18-26(19-3-5-20(6-4-19)29(42)40-15-12-21(13-16-40)30(43)45-2)28-24-10-8-23(41)17-22(24)7-9-25(28)27(31)11-14-32(31,44)33(35,36)34(37,38)39/h3-6,17,21,25-27,44H,7-16,18H2,1-2H3/t25?,26-,27+,31?,32+/m1/s1 |
| InChIKey | KSZFKGFXMIQFHU-NBVUVZKPSA-N |
| XLogP | 6.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|