C33H37F5N2O5 — CID 88918051
methyl 4-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperazine-1-carboxylate (PubChem CID 88918051) has the molecular formula C33H37F5N2O5 and a molecular weight of 636.66 g/mol. Its IUPAC name is methyl 4-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88918051 |
| Molecular Formula | C33H37F5N2O5 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | methyl 4-[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)c2ccc([C@H]3CC4(C)[C@@H](CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C33H37F5N2O5/c1-30-18-25(19-3-5-20(6-4-19)28(42)39-13-15-40(16-14-39)29(43)45-2)27-23-10-8-22(41)17-21(23)7-9-24(27)26(30)11-12-31(30,44)32(34,35)33(36,37)38/h3-6,17,24-26,44H,7-16,18H2,1-2H3/t24?,25-,26+,30?,31+/m1/s1 |
| InChIKey | AUGHLCPFROKQQW-YZSUHJAISA-N |
| XLogP | 6.04 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|