About 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol
2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol (PubChem CID 88918090) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol.
Molecular Properties
| Compound Name | 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol |
| PubChem CID | 88918090 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol |
| SMILES | C=C/C=C\c1c(N)ccc(O)c1N |
| InChI | InChI=1S/C10H12N2O/c1-2-3-4-7-8(11)5-6-9(13)10(7)12/h2-6,13H,1,11-12H2/b4-3- |
| InChIKey | UTEBSXAWUIBKCQ-ARJAWSKDSA-N |
| XLogP | 1.76 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol?
The IUPAC name of 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol (CID 88918090) is 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol.
What is the SMILES notation for 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol?
The canonical SMILES for 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol is C=C/C=C\c1c(N)ccc(O)c1N.
What is the InChIKey of 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol?
The InChIKey is UTEBSXAWUIBKCQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-3-4-7-8(11)5-6-9(13)10(7)12/h2-6,13H,1,11-12H2/b4-3-.
What are the key properties of 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol?
2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol has a molecular weight of 176.22 g/mol, XLogP of 1.76, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-3-[(1Z)-buta-1,3-dienyl]phenol is sourced from PubChem (CID 88918090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).