C34H34F5NO3 — CID 88918151
4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-phenylbenzamide (PubChem CID 88918151) has the molecular formula C34H34F5NO3 and a molecular weight of 599.64 g/mol. Its IUPAC name is 4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 88918151 |
| Molecular Formula | C34H34F5NO3 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc([C@H]2CC3(C)[C@@H](CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H34F5NO3/c1-31-19-27(20-8-10-21(11-9-20)30(42)40(2)23-6-4-3-5-7-23)29-25-15-13-24(41)18-22(25)12-14-26(29)28(31)16-17-32(31,43)33(35,36)34(37,38)39/h3-11,18,26-28,43H,12-17,19H2,1-2H3/t26?,27-,28+,31?,32+/m1/s1 |
| InChIKey | NXWSRXOELVFFJH-BEASZTTDSA-N |
| XLogP | 7.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|