About 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol
2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol (PubChem CID 88918217) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol |
| PubChem CID | 88918217 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol |
| SMILES | C=C(/C=C\C)NC(=C)CO |
| InChI | InChI=1S/C8H13NO/c1-4-5-7(2)9-8(3)6-10/h4-5,9-10H,2-3,6H2,1H3/b5-4- |
| InChIKey | DZABGLLWGIUIEO-PLNGDYQASA-N |
| XLogP | 1.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol?
The IUPAC name of 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol (CID 88918217) is 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol.
What is the SMILES notation for 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol?
The canonical SMILES for 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol is C=C(/C=C\C)NC(=C)CO.
What is the InChIKey of 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol?
The InChIKey is DZABGLLWGIUIEO-PLNGDYQASA-N. The full InChI is InChI=1S/C8H13NO/c1-4-5-7(2)9-8(3)6-10/h4-5,9-10H,2-3,6H2,1H3/b5-4-.
What are the key properties of 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol?
2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol has a molecular weight of 139.20 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3Z)-penta-1,3-dien-2-yl]amino]prop-2-en-1-ol is sourced from PubChem (CID 88918217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).