About 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol
4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol (PubChem CID 88918236) has the molecular formula C10H12F6O
and a molecular weight of 262.19 g/mol. Its IUPAC name is 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol.
Molecular Properties
| Compound Name | 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol |
| PubChem CID | 88918236 |
| Molecular Formula | C10H12F6O |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol |
| SMILES | OC(CCC1C=CCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O/c11-9(12,13)8(17,10(14,15)16)6-5-7-3-1-2-4-7/h1,3,7,17H,2,4-6H2 |
| InChIKey | CAICCJFHROHCCA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The IUPAC name of 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol (CID 88918236) is 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol.
What is the SMILES notation for 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The canonical SMILES for 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol is OC(CCC1C=CCC1)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The InChIKey is CAICCJFHROHCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F6O/c11-9(12,13)8(17,10(14,15)16)6-5-7-3-1-2-4-7/h1,3,7,17H,2,4-6H2.
What are the key properties of 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol has a molecular weight of 262.19 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopent-2-en-1-yl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol is sourced from PubChem (CID 88918236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).