C11H20N2O2S — CID 88918278
(4E,6Z)-2-amino-3-hydroxy-4-methyl-N-(2-sulfanylethyl)octa-4,6-dienamide (PubChem CID 88918278) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (4E,6Z)-2-amino-3-hydroxy-4-methyl-N-(2-sulfanylethyl)octa-4,6-dienamide.
| Compound Name | (4E,6Z)-2-amino-3-hydroxy-4-methyl-N-(2-sulfanylethyl)octa-4,6-dienamide |
|---|---|
| PubChem CID | 88918278 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (4E,6Z)-2-amino-3-hydroxy-4-methyl-N-(2-sulfanylethyl)octa-4,6-dienamide |
| SMILES | C/C=C\C=C(/C)C(O)C(N)C(=O)NCCS |
| InChI | InChI=1S/C11H20N2O2S/c1-3-4-5-8(2)10(14)9(12)11(15)13-6-7-16/h3-5,9-10,14,16H,6-7,12H2,1-2H3,(H,13,15)/b4-3-,8-5+ |
| InChIKey | YGQNIAZPIYZCTN-HMRFFJRGSA-N |
| XLogP | 0.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|