C8H8BrF3 — CID 88918352
(3E,5E)-6-bromo-4-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 88918352) has the molecular formula C8H8BrF3 and a molecular weight of 241.05 g/mol. Its IUPAC name is (3E,5E)-6-bromo-4-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3E,5E)-6-bromo-4-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 88918352 |
| Molecular Formula | C8H8BrF3 |
| Molecular Weight | 241.05 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | (3E,5E)-6-bromo-4-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C(/C)Br)C(F)(F)F |
| InChI | InChI=1S/C8H8BrF3/c1-3-4-7(5-6(2)9)8(10,11)12/h3-5H,1H2,2H3/b6-5+,7-4+ |
| InChIKey | ISPGPVDGXDUWDC-HVUXDCMCSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|