About (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine
(2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine (PubChem CID 88918558) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine |
| PubChem CID | 88918558 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine |
| SMILES | C=CCC/C=C(CNC)/N=C/C |
| InChI | InChI=1S/C10H18N2/c1-4-6-7-8-10(9-11-3)12-5-2/h4-5,8,11H,1,6-7,9H2,2-3H3/b10-8+,12-5+ |
| InChIKey | XMDDLYOXLCPRGE-ZROACKIGSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine?
The IUPAC name of (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine (CID 88918558) is (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine.
What is the SMILES notation for (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine?
The canonical SMILES for (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine is C=CCC/C=C(CNC)/N=C/C.
What is the InChIKey of (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine?
The InChIKey is XMDDLYOXLCPRGE-ZROACKIGSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-6-7-8-10(9-11-3)12-5-2/h4-5,8,11H,1,6-7,9H2,2-3H3/b10-8+,12-5+.
What are the key properties of (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine?
(2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(ethylideneamino)-N-methylhepta-2,6-dien-1-amine is sourced from PubChem (CID 88918558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).