About 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine
2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine (PubChem CID 88918608) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine |
| PubChem CID | 88918608 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine |
| SMILES | C=C(CNC)NCC |
| InChI | InChI=1S/C6H14N2/c1-4-8-6(2)5-7-3/h7-8H,2,4-5H2,1,3H3 |
| InChIKey | IKDSPGZUYXHXCV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine?
The IUPAC name of 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine (CID 88918608) is 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine.
What is the SMILES notation for 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine?
The canonical SMILES for 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine is C=C(CNC)NCC.
What is the InChIKey of 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine?
The InChIKey is IKDSPGZUYXHXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-4-8-6(2)5-7-3/h7-8H,2,4-5H2,1,3H3.
What are the key properties of 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine?
2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine has a molecular weight of 114.19 g/mol, XLogP of 0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-1-N-methylprop-2-ene-1,2-diamine is sourced from PubChem (CID 88918608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).