C24H32ClN3O4 — CID 88918953
tert-butyl N-[(2S)-1-[(3R)-3-(1-chloroisoquinolin-6-yl)oxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 88918953) has the molecular formula C24H32ClN3O4 and a molecular weight of 461.99 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(3R)-3-(1-chloroisoquinolin-6-yl)oxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(3R)-3-(1-chloroisoquinolin-6-yl)oxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 88918953 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(3R)-3-(1-chloroisoquinolin-6-yl)oxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC[C@@H](Oc2ccc3c(Cl)nccc3c2)C1)C(C)(C)C |
| InChI | InChI=1S/C24H32ClN3O4/c1-23(2,3)19(27-22(30)32-24(4,5)6)21(29)28-12-10-17(14-28)31-16-7-8-18-15(13-16)9-11-26-20(18)25/h7-9,11,13,17,19H,10,12,14H2,1-6H3,(H,27,30)/t17-,19-/m1/s1 |
| InChIKey | FWJAXWOMRVKDOX-IEBWSBKVSA-N |
| XLogP | 4.81 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|