About 2-amino-6-imino-2,5-dimethylheptan-3-ol
2-amino-6-imino-2,5-dimethylheptan-3-ol (PubChem CID 88919279) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-amino-6-imino-2,5-dimethylheptan-3-ol.
Molecular Properties
| Compound Name | 2-amino-6-imino-2,5-dimethylheptan-3-ol |
| PubChem CID | 88919279 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-amino-6-imino-2,5-dimethylheptan-3-ol |
| SMILES | [H]/N=C(\C)C(C)CC(O)C(C)(C)N |
| InChI | InChI=1S/C9H20N2O/c1-6(7(2)10)5-8(12)9(3,4)11/h6,8,10,12H,5,11H2,1-4H3/b10-7+ |
| InChIKey | ITRCVVLQAXHUBN-JXMROGBWSA-N |
| XLogP | 1.15 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-imino-2,5-dimethylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-imino-2,5-dimethylheptan-3-ol?
The IUPAC name of 2-amino-6-imino-2,5-dimethylheptan-3-ol (CID 88919279) is 2-amino-6-imino-2,5-dimethylheptan-3-ol.
What is the SMILES notation for 2-amino-6-imino-2,5-dimethylheptan-3-ol?
The canonical SMILES for 2-amino-6-imino-2,5-dimethylheptan-3-ol is [H]/N=C(\C)C(C)CC(O)C(C)(C)N.
What is the InChIKey of 2-amino-6-imino-2,5-dimethylheptan-3-ol?
The InChIKey is ITRCVVLQAXHUBN-JXMROGBWSA-N. The full InChI is InChI=1S/C9H20N2O/c1-6(7(2)10)5-8(12)9(3,4)11/h6,8,10,12H,5,11H2,1-4H3/b10-7+.
What are the key properties of 2-amino-6-imino-2,5-dimethylheptan-3-ol?
2-amino-6-imino-2,5-dimethylheptan-3-ol has a molecular weight of 172.27 g/mol, XLogP of 1.15, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-imino-2,5-dimethylheptan-3-ol is sourced from PubChem (CID 88919279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).