C14H9Cl2F3I2N2O4 — CID 88919641
1-(6-chloro-5-hydroxy-4-iodo-2-pyridinyl)-1-[6-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethane-1,2-diol (PubChem CID 88919641) has the molecular formula C14H9Cl2F3I2N2O4 and a molecular weight of 650.94 g/mol. Its IUPAC name is 1-(6-chloro-5-hydroxy-4-iodo-2-pyridinyl)-1-[6-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethane-1,2-diol.
| Compound Name | 1-(6-chloro-5-hydroxy-4-iodo-2-pyridinyl)-1-[6-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88919641 |
| Molecular Formula | C14H9Cl2F3I2N2O4 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 649.80 |
| IUPAC Name | 1-(6-chloro-5-hydroxy-4-iodo-2-pyridinyl)-1-[6-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethane-1,2-diol |
| SMILES | OCC(O)(c1cc(I)c(O)c(Cl)n1)c1cc(I)c(OCC(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C14H9Cl2F3I2N2O4/c15-11-9(25)5(20)1-7(22-11)13(26,3-24)8-2-6(21)10(12(16)23-8)27-4-14(17,18)19/h1-2,24-26H,3-4H2 |
| InChIKey | QBDVZCURJJYXJC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|