C26H34AsClN5O4 — CID 88919842
CID 88919842 (PubChem CID 88919842) has the molecular formula C26H34AsClN5O4 and a molecular weight of 590.96 g/mol.
| Compound Name | CID 88919842 |
|---|---|
| PubChem CID | 88919842 |
| Molecular Formula | C26H34AsClN5O4 |
| Molecular Weight | 590.96 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | — |
| SMILES | COC[C@@H](C)NC1CCC([As]c2cc(-c3c[nH]c(=O)c(OCC4(C#N)CCOCC4)n3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C26H34AsClN5O4/c1-17(14-35-2)32-19-5-3-18(4-6-19)27-23-11-20(21(28)12-30-23)22-13-31-24(34)25(33-22)37-16-26(15-29)7-9-36-10-8-26/h11-13,17-19,32H,3-10,14,16H2,1-2H3,(H,31,34)/t17-,18?,19?/m1/s1 |
| InChIKey | FFAVQRNVBVFYLS-LMDPOFIKSA-N |
| XLogP | 2.87 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|