C32H27Cl2F2N5O4 — CID 88920152
2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-2-yl]pyridine (PubChem CID 88920152) has the molecular formula C32H27Cl2F2N5O4 and a molecular weight of 654.50 g/mol. Its IUPAC name is 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-2-yl]pyridine.
| Compound Name | 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 88920152 |
| Molecular Formula | C32H27Cl2F2N5O4 |
| Molecular Weight | 654.50 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-2-yl]pyridine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(N3CCCCC3c3ccccn3)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H27Cl2F2N5O4/c33-22-9-7-19(15-30(22)40(42)43)27-11-12-28(20-8-10-23(34)31(16-20)41(44)45)39(27)21-17-24(35)32(25(36)18-21)38-14-4-2-6-29(38)26-5-1-3-13-37-26/h1,3,5,7-10,13,15-18,27-29H,2,4,6,11-12,14H2/t27-,28-,29?/m1/s1 |
| InChIKey | PXMQBIABRGNWGC-KSSJMHQNSA-N |
| XLogP | 9.30 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.50 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|