C6H12N2O2S — CID 88920180
4-(carbamothioylamino)-2-methylbutanoic acid (PubChem CID 88920180) has the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. Its IUPAC name is 4-(carbamothioylamino)-2-methylbutanoic acid.
| Compound Name | 4-(carbamothioylamino)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 88920180 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-(carbamothioylamino)-2-methylbutanoic acid |
| SMILES | CC(CCNC(N)=S)C(=O)O |
| InChI | InChI=1S/C6H12N2O2S/c1-4(5(9)10)2-3-8-6(7)11/h4H,2-3H2,1H3,(H,9,10)(H3,7,8,11) |
| InChIKey | FUZKEFITGFNDPU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|