About 2-tert-butylperoxy-2-methylpropane;decane
2-tert-butylperoxy-2-methylpropane;decane (PubChem CID 88920402) has the molecular formula C18H40O2
and a molecular weight of 288.52 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;decane.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2-methylpropane;decane |
| PubChem CID | 88920402 |
| Molecular Formula | C18H40O2 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.30 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;decane |
| SMILES | CC(C)(C)OOC(C)(C)C.CCCCCCCCCC |
| InChI | InChI=1S/C10H22.C8H18O2/c1-3-5-7-9-10-8-6-4-2;1-7(2,3)9-10-8(4,5)6/h3-10H2,1-2H3;1-6H3 |
| InChIKey | SCIUVPISKYHUMQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2-methylpropane;decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2-methylpropane;decane?
The IUPAC name of 2-tert-butylperoxy-2-methylpropane;decane (CID 88920402) is 2-tert-butylperoxy-2-methylpropane;decane.
What is the SMILES notation for 2-tert-butylperoxy-2-methylpropane;decane?
The canonical SMILES for 2-tert-butylperoxy-2-methylpropane;decane is CC(C)(C)OOC(C)(C)C.CCCCCCCCCC.
What is the InChIKey of 2-tert-butylperoxy-2-methylpropane;decane?
The InChIKey is SCIUVPISKYHUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C8H18O2/c1-3-5-7-9-10-8-6-4-2;1-7(2,3)9-10-8(4,5)6/h3-10H2,1-2H3;1-6H3.
What are the key properties of 2-tert-butylperoxy-2-methylpropane;decane?
2-tert-butylperoxy-2-methylpropane;decane has a molecular weight of 288.52 g/mol, XLogP of 6.68, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2-methylpropane;decane is sourced from PubChem (CID 88920402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).