C10H7Cl3F3NO — CID 88920445
2-(3,4,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 88920445) has the molecular formula C10H7Cl3F3NO and a molecular weight of 320.53 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(3,4,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 88920445 |
| Molecular Formula | C10H7Cl3F3NO |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1cc(Cl)c(Cl)c(Cl)c1)NCC(F)(F)F |
| InChI | InChI=1S/C10H7Cl3F3NO/c11-6-1-5(2-7(12)9(6)13)3-8(18)17-4-10(14,15)16/h1-2H,3-4H2,(H,17,18) |
| InChIKey | XNAJFTPSEPDQMW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|