C15H25NO — CID 88920479
(2E,4E)-2-ethenyl-4-[(Z)-hept-4-en-2-yl]oxyhexa-2,4-dien-1-amine (PubChem CID 88920479) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-4-[(Z)-hept-4-en-2-yl]oxyhexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethenyl-4-[(Z)-hept-4-en-2-yl]oxyhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88920479 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2E,4E)-2-ethenyl-4-[(Z)-hept-4-en-2-yl]oxyhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)OC(C)C/C=C\CC)CN |
| InChI | InChI=1S/C15H25NO/c1-5-8-9-10-13(4)17-15(7-3)11-14(6-2)12-16/h6-9,11,13H,2,5,10,12,16H2,1,3-4H3/b9-8-,14-11+,15-7+ |
| InChIKey | UDYIQIQIZHSFAD-BAUJUIKOSA-N |
| XLogP | 3.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|