C24H11F3O6 — CID 88921212
4-[1-(1,3-dioxo-2-benzofuran-4-yl)-2,2,2-trifluoro-1-phenylethyl]-2-benzofuran-1,3-dione (PubChem CID 88921212) has the molecular formula C24H11F3O6 and a molecular weight of 452.34 g/mol. Its IUPAC name is 4-[1-(1,3-dioxo-2-benzofuran-4-yl)-2,2,2-trifluoro-1-phenylethyl]-2-benzofuran-1,3-dione.
| Compound Name | 4-[1-(1,3-dioxo-2-benzofuran-4-yl)-2,2,2-trifluoro-1-phenylethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88921212 |
| Molecular Formula | C24H11F3O6 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-[1-(1,3-dioxo-2-benzofuran-4-yl)-2,2,2-trifluoro-1-phenylethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1cccc2C(c1ccccc1)(c1cccc2c1C(=O)OC2=O)C(F)(F)F |
| InChI | InChI=1S/C24H11F3O6/c25-24(26,27)23(12-6-2-1-3-7-12,15-10-4-8-13-17(15)21(30)32-19(13)28)16-11-5-9-14-18(16)22(31)33-20(14)29/h1-11H |
| InChIKey | WUPKILHLNQXGDY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|