About 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde
2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde (PubChem CID 88921262) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde |
| PubChem CID | 88921262 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde |
| SMILES | Nc1ncc(Oc2ccc(CC=O)cc2)s1 |
| InChI | InChI=1S/C11H10N2O2S/c12-11-13-7-10(16-11)15-9-3-1-8(2-4-9)5-6-14/h1-4,6-7H,5H2,(H2,12,13) |
| InChIKey | GSDIDFSEVWGODV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde?
The IUPAC name of 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde (CID 88921262) is 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde.
What is the SMILES notation for 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde?
The canonical SMILES for 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde is Nc1ncc(Oc2ccc(CC=O)cc2)s1.
What is the InChIKey of 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde?
The InChIKey is GSDIDFSEVWGODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c12-11-13-7-10(16-11)15-9-3-1-8(2-4-9)5-6-14/h1-4,6-7H,5H2,(H2,12,13).
What are the key properties of 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde?
2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde has a molecular weight of 234.28 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetaldehyde is sourced from PubChem (CID 88921262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).