About N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine (PubChem CID 88921341) has the molecular formula C25H29N3O5
and a molecular weight of 451.52 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine.
Molecular Properties
| Compound Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine |
| PubChem CID | 88921341 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine |
| SMILES | C#Cc1cccc(/N=c2/c3cc(OCCOC)c(OCCOC)cc3ncn2CCOC)c1 |
| InChI | InChI=1S/C25H29N3O5/c1-5-19-7-6-8-20(15-19)27-25-21-16-23(32-13-11-30-3)24(33-14-12-31-4)17-22(21)26-18-28(25)9-10-29-2/h1,6-8,15-18H,9-14H2,2-4H3/b27-25- |
| InChIKey | YPNBARZXUDCGGJ-RFBIWTDZSA-N |
| XLogP | 2.95 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine?
The IUPAC name of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine (CID 88921341) is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine.
What is the SMILES notation for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine?
The canonical SMILES for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine is C#Cc1cccc(/N=c2/c3cc(OCCOC)c(OCCOC)cc3ncn2CCOC)c1.
What is the InChIKey of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine?
The InChIKey is YPNBARZXUDCGGJ-RFBIWTDZSA-N. The full InChI is InChI=1S/C25H29N3O5/c1-5-19-7-6-8-20(15-19)27-25-21-16-23(32-13-11-30-3)24(33-14-12-31-4)17-22(21)26-18-28(25)9-10-29-2/h1,6-8,15-18H,9-14H2,2-4H3/b27-25-.
What are the key properties of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine?
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine has a molecular weight of 451.52 g/mol, XLogP of 2.95, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-3-(2-methoxyethyl)quinazolin-4-imine is sourced from PubChem (CID 88921341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).