C24H38N2O3 — CID 88921714
(5Z,8Z,14Z,17Z)-N-[2-(2-amino-2-oxoethoxy)ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 88921714) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is (5Z,8Z,14Z,17Z)-N-[2-(2-amino-2-oxoethoxy)ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,14Z,17Z)-N-[2-(2-amino-2-oxoethoxy)ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 88921714 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | (5Z,8Z,14Z,17Z)-N-[2-(2-amino-2-oxoethoxy)ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\CC=CC/C=C\C/C=C\CCCC(=O)NCCOCC(N)=O |
| InChI | InChI=1S/C24H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(28)26-20-21-29-22-23(25)27/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-22H2,1H3,(H2,25,27)(H,26,28)/b4-3-,7-6-,10-9?,13-12-,16-15- |
| InChIKey | MGFUWMUBLZNTFH-AVVVFXBPSA-N |
| XLogP | 4.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|