C19H26ClFN2O7S — CID 88921984
tert-butyl (2S,4S)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-hydroxy-2-methyl-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 88921984) has the molecular formula C19H26ClFN2O7S and a molecular weight of 480.94 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-hydroxy-2-methyl-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-hydroxy-2-methyl-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88921984 |
| Molecular Formula | C19H26ClFN2O7S |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | tert-butyl (2S,4S)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-hydroxy-2-methyl-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@](O)(OS(C)(=O)=O)C[C@@]1(C)C(=O)NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C19H26ClFN2O7S/c1-17(2,3)29-16(25)23-11-19(26,30-31(5,27)28)10-18(23,4)15(24)22-9-12-7-6-8-13(20)14(12)21/h6-8,26H,9-11H2,1-5H3,(H,22,24)/t18-,19-/m0/s1 |
| InChIKey | OFYDQOBCORNYDS-OALUTQOASA-N |
| XLogP | 2.16 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|