C23H22ClFN4O4 — CID 88921998
3-[2-[(2S,3R)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]indole-1-carboxamide (PubChem CID 88921998) has the molecular formula C23H22ClFN4O4 and a molecular weight of 472.90 g/mol. Its IUPAC name is 3-[2-[(2S,3R)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]indole-1-carboxamide.
| Compound Name | 3-[2-[(2S,3R)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 88921998 |
| Molecular Formula | C23H22ClFN4O4 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-[2-[(2S,3R)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]indole-1-carboxamide |
| SMILES | NC(=O)n1cc(CC(=O)N2CC[C@@H](O)[C@H]2C(=O)N(F)Cc2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C23H22ClFN4O4/c24-16-5-3-4-14(10-16)12-29(25)22(32)21-19(30)8-9-27(21)20(31)11-15-13-28(23(26)33)18-7-2-1-6-17(15)18/h1-7,10,13,19,21,30H,8-9,11-12H2,(H2,26,33)/t19-,21+/m1/s1 |
| InChIKey | SVYDRMIKHJWAAM-CTNGQTDRSA-N |
| XLogP | 2.64 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|