C24H33N — CID 88922256
4-[(E)-2-[(3E)-3-[(E)-but-2-enylidene]-5,5-dimethylcyclohexen-1-yl]ethenyl]-N,N-diethylaniline (PubChem CID 88922256) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is 4-[(E)-2-[(3E)-3-[(E)-but-2-enylidene]-5,5-dimethylcyclohexen-1-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-[(3E)-3-[(E)-but-2-enylidene]-5,5-dimethylcyclohexen-1-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 88922256 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 4-[(E)-2-[(3E)-3-[(E)-but-2-enylidene]-5,5-dimethylcyclohexen-1-yl]ethenyl]-N,N-diethylaniline |
| SMILES | C/C=C/C=C1/C=C(/C=C/c2ccc(N(CC)CC)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C24H33N/c1-6-9-10-21-17-22(19-24(4,5)18-21)12-11-20-13-15-23(16-14-20)25(7-2)8-3/h6,9-17H,7-8,18-19H2,1-5H3/b9-6+,12-11+,21-10- |
| InChIKey | PLNJFMWJYYCNEB-GJJHOQPJSA-N |
| XLogP | 6.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|