About 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one
3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one (PubChem CID 8892226) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one |
| PubChem CID | 8892226 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C21H22N4O2/c1-15-18(16(2)25(22-15)17-9-5-4-6-10-17)13-23(3)14-24-19-11-7-8-12-20(19)27-21(24)26/h4-12H,13-14H2,1-3H3 |
| InChIKey | YITPWSMAMQSHCH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one (CID 8892226) is 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one is Cc1nn(-c2ccccc2)c(C)c1CN(C)Cn1c(=O)oc2ccccc21.
What is the InChIKey of 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one?
The InChIKey is YITPWSMAMQSHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O2/c1-15-18(16(2)25(22-15)17-9-5-4-6-10-17)13-23(3)14-24-19-11-7-8-12-20(19)27-21(24)26/h4-12H,13-14H2,1-3H3.
What are the key properties of 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one?
3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one has a molecular weight of 362.43 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 8892226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).