About N-ethenylpropanimidoyl chloride
N-ethenylpropanimidoyl chloride (PubChem CID 88922327) has the molecular formula C5H8ClN
and a molecular weight of 117.58 g/mol. Its IUPAC name is N-ethenylpropanimidoyl chloride.
Molecular Properties
| Compound Name | N-ethenylpropanimidoyl chloride |
| PubChem CID | 88922327 |
| Molecular Formula | C5H8ClN |
| Molecular Weight | 117.58 g/mol |
| Exact Mass | 117.03 |
| IUPAC Name | N-ethenylpropanimidoyl chloride |
| SMILES | C=C/N=C(\Cl)CC |
| InChI | InChI=1S/C5H8ClN/c1-3-5(6)7-4-2/h4H,2-3H2,1H3/b7-5- |
| InChIKey | YCWYZKGZYNYRGS-ALCCZGGFSA-N |
| XLogP | 2.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylpropanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylpropanimidoyl chloride?
The IUPAC name of N-ethenylpropanimidoyl chloride (CID 88922327) is N-ethenylpropanimidoyl chloride.
What is the SMILES notation for N-ethenylpropanimidoyl chloride?
The canonical SMILES for N-ethenylpropanimidoyl chloride is C=C/N=C(\Cl)CC.
What is the InChIKey of N-ethenylpropanimidoyl chloride?
The InChIKey is YCWYZKGZYNYRGS-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H8ClN/c1-3-5(6)7-4-2/h4H,2-3H2,1H3/b7-5-.
What are the key properties of N-ethenylpropanimidoyl chloride?
N-ethenylpropanimidoyl chloride has a molecular weight of 117.58 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylpropanimidoyl chloride is sourced from PubChem (CID 88922327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).