C20H38N2 — CID 88922494
(7E,11E,15E)-6,6,7-trimethylheptadeca-7,11,15-triene-1,5-diamine (PubChem CID 88922494) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is (7E,11E,15E)-6,6,7-trimethylheptadeca-7,11,15-triene-1,5-diamine.
| Compound Name | (7E,11E,15E)-6,6,7-trimethylheptadeca-7,11,15-triene-1,5-diamine |
|---|---|
| PubChem CID | 88922494 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | (7E,11E,15E)-6,6,7-trimethylheptadeca-7,11,15-triene-1,5-diamine |
| SMILES | C/C=C/CC/C=C/CC/C=C(\C)C(C)(C)C(N)CCCCN |
| InChI | InChI=1S/C20H38N2/c1-5-6-7-8-9-10-11-12-15-18(2)20(3,4)19(22)16-13-14-17-21/h5-6,9-10,15,19H,7-8,11-14,16-17,21-22H2,1-4H3/b6-5+,10-9+,18-15+ |
| InChIKey | XZIUSLRCIDHGOP-JLVKLCHISA-N |
| XLogP | 5.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|