C24H14N4O10S2 — CID 88922723
1H-benzo[g]pteridine-2,4-dione;9,10-dioxoanthracene-1,5-disulfonic acid (PubChem CID 88922723) has the molecular formula C24H14N4O10S2 and a molecular weight of 582.53 g/mol. Its IUPAC name is 1H-benzo[g]pteridine-2,4-dione;9,10-dioxoanthracene-1,5-disulfonic acid.
| Compound Name | 1H-benzo[g]pteridine-2,4-dione;9,10-dioxoanthracene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 88922723 |
| Molecular Formula | C24H14N4O10S2 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 1H-benzo[g]pteridine-2,4-dione;9,10-dioxoanthracene-1,5-disulfonic acid |
| SMILES | O=C1c2cccc(S(=O)(=O)O)c2C(=O)c2cccc(S(=O)(=O)O)c21.O=c1[nH]c(=O)c2nc3ccccc3nc2[nH]1 |
| InChI | InChI=1S/C14H8O8S2.C10H6N4O2/c15-13-7-3-1-5-9(23(17,18)19)11(7)14(16)8-4-2-6-10(12(8)13)24(20,21)22;15-9-7-8(13-10(16)14-9)12-6-4-2-1-3-5(6)11-7/h1-6H,(H,17,18,19)(H,20,21,22);1-4H,(H2,12,13,14,15,16) |
| InChIKey | BWFZVXAHEKIEIM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 234.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|