C19H16N4O3S — CID 8892298
2-[2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 8892298) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8892298 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[2-[(4-benzyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSc1n[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H16N4O3S/c24-16-14-8-4-5-9-15(14)17(25)22(16)10-11-27-19-21-20-18(26)23(19)12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,26) |
| InChIKey | UIMDFEJXDXKXMO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|