C22H18FN3O4 — CID 88923055
5-[(Z)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide (PubChem CID 88923055) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is 5-[(Z)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide.
| Compound Name | 5-[(Z)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88923055 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5-[(Z)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-N-hydroxy-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
| SMILES | O=C(NO)c1noc2c1CN(C(=O)/C(=C\c1ccccc1)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H18FN3O4/c23-16-8-6-15(7-9-16)17(12-14-4-2-1-3-5-14)22(28)26-11-10-19-18(13-26)20(25-30-19)21(27)24-29/h1-9,12,29H,10-11,13H2,(H,24,27)/b17-12- |
| InChIKey | YNQLULYZRHBWLX-ATVHPVEESA-N |
| XLogP | 3.06 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|