C29H46O9 — CID 88923468
2,2-bis[[2-methyl-4-(3-methyloxiran-2-yl)butanoyl]oxymethyl]butyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 88923468) has the molecular formula C29H46O9 and a molecular weight of 538.68 g/mol. Its IUPAC name is 2,2-bis[[2-methyl-4-(3-methyloxiran-2-yl)butanoyl]oxymethyl]butyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | 2,2-bis[[2-methyl-4-(3-methyloxiran-2-yl)butanoyl]oxymethyl]butyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 88923468 |
| Molecular Formula | C29H46O9 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2,2-bis[[2-methyl-4-(3-methyloxiran-2-yl)butanoyl]oxymethyl]butyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CCC(COC(=O)C(C)CCC1OC1C)(COC(=O)C(C)CCC1OC1C)COC(=O)C1CCC2OC2C1 |
| InChI | InChI=1S/C29H46O9/c1-6-29(14-33-26(30)17(2)7-10-22-19(4)36-22,15-34-27(31)18(3)8-11-23-20(5)37-23)16-35-28(32)21-9-12-24-25(13-21)38-24/h17-25H,6-16H2,1-5H3 |
| InChIKey | WEKZMDLDTGECEF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|