C14H23NO3 — CID 88923667
tert-butyl N-[(2E,4E)-6-methoxy-4-methylhepta-2,4,6-trien-3-yl]carbamate (PubChem CID 88923667) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E)-6-methoxy-4-methylhepta-2,4,6-trien-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E)-6-methoxy-4-methylhepta-2,4,6-trien-3-yl]carbamate |
|---|---|
| PubChem CID | 88923667 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl N-[(2E,4E)-6-methoxy-4-methylhepta-2,4,6-trien-3-yl]carbamate |
| SMILES | C=C(/C=C(C)/C(=C\C)NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C14H23NO3/c1-8-12(10(2)9-11(3)17-7)15-13(16)18-14(4,5)6/h8-9H,3H2,1-2,4-7H3,(H,15,16)/b10-9+,12-8+ |
| InChIKey | YJHJMSZGLDPZON-RSPOHRJYSA-N |
| XLogP | 3.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|