About 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde
2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde (PubChem CID 88923716) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde |
| PubChem CID | 88923716 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde |
| SMILES | O=CCc1cc(CO)on1 |
| InChI | InChI=1S/C6H7NO3/c8-2-1-5-3-6(4-9)10-7-5/h2-3,9H,1,4H2 |
| InChIKey | FNLBTGJSKCXWID-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde?
The IUPAC name of 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde (CID 88923716) is 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde.
What is the SMILES notation for 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde?
The canonical SMILES for 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde is O=CCc1cc(CO)on1.
What is the InChIKey of 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde?
The InChIKey is FNLBTGJSKCXWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-2-1-5-3-6(4-9)10-7-5/h2-3,9H,1,4H2.
What are the key properties of 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde?
2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde has a molecular weight of 141.13 g/mol, XLogP of -0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(hydroxymethyl)-1,2-oxazol-3-yl]acetaldehyde is sourced from PubChem (CID 88923716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).