C19H27F3N4O7S — CID 88923920
methyl 2-(butoxycarbonylamino)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]propanoate (PubChem CID 88923920) has the molecular formula C19H27F3N4O7S and a molecular weight of 512.51 g/mol. Its IUPAC name is methyl 2-(butoxycarbonylamino)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 2-(butoxycarbonylamino)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 88923920 |
| Molecular Formula | C19H27F3N4O7S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | methyl 2-(butoxycarbonylamino)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl]amino]propanoate |
| SMILES | CCCCOC(=O)NC(C)(NC(=O)c1sc(NC(=O)OC(C)(C)C)nc1C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C19H27F3N4O7S/c1-7-8-9-32-16(30)26-18(5,13(28)31-6)25-12(27)10-11(19(20,21)22)23-14(34-10)24-15(29)33-17(2,3)4/h7-9H2,1-6H3,(H,25,27)(H,26,30)(H,23,24,29) |
| InChIKey | GLJPHUTVHKEOMW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|