C31H30N6O6 — CID 88924027
N-[4-[5-[5-[(2S)-1-acetylpyrrolidin-2-yl]-4-formamidocyclohexa-1,3-dien-1-yl]-1,3-oxazol-2-yl]phenyl]-1-(1,2-oxazole-5-carbonyl)-2,5-dihydropyrrole-2-carboxamide (PubChem CID 88924027) has the molecular formula C31H30N6O6 and a molecular weight of 582.62 g/mol. Its IUPAC name is N-[4-[5-[5-[(2S)-1-acetylpyrrolidin-2-yl]-4-formamidocyclohexa-1,3-dien-1-yl]-1,3-oxazol-2-yl]phenyl]-1-(1,2-oxazole-5-carbonyl)-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | N-[4-[5-[5-[(2S)-1-acetylpyrrolidin-2-yl]-4-formamidocyclohexa-1,3-dien-1-yl]-1,3-oxazol-2-yl]phenyl]-1-(1,2-oxazole-5-carbonyl)-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 88924027 |
| Molecular Formula | C31H30N6O6 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | N-[4-[5-[5-[(2S)-1-acetylpyrrolidin-2-yl]-4-formamidocyclohexa-1,3-dien-1-yl]-1,3-oxazol-2-yl]phenyl]-1-(1,2-oxazole-5-carbonyl)-2,5-dihydropyrrole-2-carboxamide |
| SMILES | CC(=O)N1CCC[C@H]1C1CC(c2cnc(-c3ccc(NC(=O)C4C=CCN4C(=O)c4ccno4)cc3)o2)=CC=C1NC=O |
| InChI | InChI=1S/C31H30N6O6/c1-19(39)36-14-2-4-25(36)23-16-21(8-11-24(23)33-18-38)28-17-32-30(42-28)20-6-9-22(10-7-20)35-29(40)26-5-3-15-37(26)31(41)27-12-13-34-43-27/h3,5-13,17-18,23,25-26H,2,4,14-16H2,1H3,(H,33,38)(H,35,40)/t23?,25-,26?/m0/s1 |
| InChIKey | KFUBCRGEONPJAY-DHWVBAGJSA-N |
| XLogP | 3.39 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|